Merck 2,2′-Azino-bis(3-ethylbenzothiazoline-6-sulfonic acid)
상품 옵션 정보 | ||||||||
---|---|---|---|---|---|---|---|---|
카탈로그 번호 | CAS 번호 | 설명 | 상태 | 단위 | 판매가 | 할인가 | 가격(VAT포함) | 수량 / 장바구니 / 찜 |
A3219-100ML | - | Merck A3219-100ML 2,2′-Azino-bis(3-ethylbenzothiazoline-6-sulfonic acid), 100 ML pk | 재고문의 | pk | 259,460원 | - | 285,406원 |
2,2′-Azino-bis(3-ethylbenzothiazoline-6-sulfonic acid)
Liquid Substrate System
Quality Level
form
liquid
저장 온도
2-8°C
SMILES string
CCN1C(\Sc2cc(ccc12)S(O)(=O)=O)=N\N=C3/Sc4cc(ccc4N3CC)S(O)(=O)=O
InChI
1S/C18H18N4O6S4/c1-3-21-13-7-5-11(31(23,24)25)9-15(13)29-17(21)19-20-18-22(4-2)14-8-6-12(32(26,27)28)10-16(14)30-18/h5-10H,3-4H2,1-2H3,(H,23,24,25)(H,26,27,28)/b19-17-,20-18-
InChI key
ZTOJFFHGPLIVKC-CLFAGFIQSA-N
The product is supplied as a ready-to-use one component substrate for peroxidase consisting 2,2′-azino-bis (3-ethylbenz-thiazoline-6-sulfonic acid) in an acidic buffer. The substrate is colorless before reacting with peroxidase and produces a blue-green color reaction product after reacting with it. 1% sodium dodecyl sulfate (SDS) may be used to stop the reaction during end-point assays. Since this substrate produces a soluble reaction product, it is not recommended for immunoblotting or histochemical applications.
배송/결제/교환/반품 안내
배송 정보
기본 배송비 |
| 교환/반품 배송비 |
|
---|---|---|---|
착불 배송비 |
| ||
교환/반품 배송비 |
|
결제 및 환불 안내
결제 방법 |
|
---|---|
취소 |
|
반품 |
|
환급 |
|
교환 및 반품 접수
교환 및 반품 접수 기한 |
|
---|---|
교환 및 반품 접수가 가능한 경우 |
|
교환 및 반품 접수가 불가능한 경우 |
|
교환 및 반품 신청
교환 절차 |
|
---|---|
반품 절차 |
|