Merck Arachidonoyl coenzyme A lithium salt
Arachidonoyl coenzyme A lithium salt
≥85%
_cis,cis,cis,cis_-5,8,11,14-Eicosatetraenoyl coenzyme A lithium salt, Arachidonoyl CoA lithium salt
Quality Level
assay
≥85%
form
powder
저장 온도
−20°C
SMILES string
[Li+].CCCCC\C=C\C\C=C\C\C=C\C\C=C\CCCC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)([O-])=O)n2cnc3c(N)ncnc23
InChI
1S/C41H66N7O17P3S.Li/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-32(50)69-25-24-43-31(49)22-23-44-39(53)36(52)41(2,3)27-62-68(59,60)65-67(57,58)61-26-30-35(64-66(54,55)56)34(51)40(63-30)48-29-47-33-37(42)45-28-46-38(33)48;/h8-9,11-12,14-15,17-18,28-30,34-36,40,51-52H,4-7,10,13,16,19-27H2,1-3H3,(H,43,49)(H,44,53)(H,57,58)(H,59,60)(H2,42,45,46)(H2,54,55,56);/q;+1/p-1/b9-8+,12-11+,15-14+,18-17+;/t30-,34-,35-,36+,40-;/m1./s1
InChI key
PFJKRDANWCBXHE-VKSULDSYSA-M
Arachidonoyl coenzyme (Arachidonoyl CoA) is used as a substrate for the long-chain N-acylation of glycines by enzymes such as glycine N-acyltransferase-like 2 (GLYATL2) and of acytransferases such as lysophosphatidic acid acyltransferase (CGI-58/ABHD5). Arachidonoyl CoA is used as a charged membrane-impermeant analog of arachidonic acid (AA). Arachidonoyl CoA is used in the synthesis of arachidonoyl amino acids by cytochrome c.
배송/결제/교환/반품 안내
배송 정보
기본 배송비 |
| 교환/반품 배송비 |
|
---|---|---|---|
착불 배송비 |
| ||
교환/반품 배송비 |
|
결제 및 환불 안내
결제수단 |
|
---|---|
취소 |
|
반품 |
|
환급 |
|
교환 및 반품 접수
교환 및 반품 접수 기한 |
|
---|---|
교환 및 반품 접수가 가능한 경우 |
|
교환 및 반품 접수가 불가능한 경우 |
|
교환 및 반품 신청
교환 절차 |
|
---|---|
반품 절차 |
|