
Merck Succinyl coenzyme A sodium salt
✨AI 추천 연관 상품
AI가 분석한 이 상품과 연관된 추천 상품들을 확인해보세요
연관 상품을 찾고 있습니다...
Succinyl coenzyme A sodium salt
≥85%
C25H40N7O19P3S
Quality Level
assay
≥85%
form
powder
solubility
water: 50 mg/mL, clear, colorless
저장 온도
−20°C
SMILES string
[Na+].[Na+].CC(C)(COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)([O-])=O)n2cnc3c(N)ncnc23)C(O)C(=O)NCCC(=O)NCCSC(=O)CCC([O-])=O
Succinyl coenzyme A sodium salt has been used:
- for the nonenzymatic succinylation of lysine in vitro,
- as a substrate for adipic acid biosynthesis in recombinant E. coli
- in isocitrate dehydrogenase (ICDH) treatment for the succinylation of proteins
- as a substrate to study the specificity and kinetics of enzymes such as acetate:succinate CoA-transferase and 5-aminolevulinate synthase (ALA synthase)
배송/결제/교환/반품 안내
배송 정보
기본 배송비 |
| 교환/반품 배송비 |
|
---|---|---|---|
착불 배송비 |
| ||
교환/반품 배송비 |
|
결제 및 환불 안내
결제수단 |
|
---|---|
취소 |
|
반품 |
|
환급 |
|
교환 및 반품 접수
교환 및 반품 접수 기한 |
|
---|---|
교환 및 반품 접수가 가능한 경우 |
|
교환 및 반품 접수가 불가능한 경우 |
|
교환 및 반품 신청
교환 절차 |
|
---|---|
반품 절차 |
|
문의 0
로그인 후 문의를 할 수 있습니다.