Merck Meclofenamic acid sodium salt
상품 옵션 정보 | |||||||||
---|---|---|---|---|---|---|---|---|---|
카탈로그 번호 | CAS 번호 | 설명 | 상태 | 재고 | 단위 | 판매가 | 할인가 | 가격(VAT포함) | 수량 / 장바구니 / 찜 |
M4531-5G | - | Merck M4531-5G Meclofenamic acid sodium salt, 5 G pk | 재고문의 | 0 | pk | 325,400원 | - | 357,940원 | |
M4531-1G | - | Merck M4531-1G Meclofenamic acid sodium salt, 1 G pk | 재고문의 | 0 | pk | 114,600원 | - | 126,060원 |
Meclofenamic acid sodium salt
생물학적 소스
synthetic (organic)
Quality Level
assay
≥93% (HPLC)
form
powder
solubility
water: 50 mg/mL, clear, colorless to faintly brownish-yellow
water: 50 mg/mL, clear, colorless to faintly yellow
water: 50 mg/mL, clear, colorless to very faintly brown
주관자
Pfizer
SMILES string
[Na].Cc1ccc(Cl)c(Nc2ccccc2C(O)=O)c1Cl
InChI
1S/C14H11Cl2NO2.Na.H/c1-8-6-7-10(15)13(12(8)16)17-11-5-3-2-4-9(11)14(18)19;;/h2-7,17H,1H3,(H,18,19);;
InChI key
CHGIZYUDGOIAFY-UHFFFAOYSA-N
Meclofenamic acid consists of two aryl moieties that are twisted in perpendicular orientation, it includes N-2,6-dichloro-3-methylphenyl group and N-2-benzoic acid group. Because of the low aqueous solubility of the compound, it is commercially available as sodium salt.
배송/결제/교환/반품 안내
배송 정보
기본 배송비 |
| 교환/반품 배송비 |
|
---|---|---|---|
착불 배송비 |
| ||
교환/반품 배송비 |
|
결제 및 환불 안내
결제 방법 |
|
---|---|
취소 |
|
반품 |
|
환급 |
|
교환 및 반품 접수
교환 및 반품 접수 기한 |
|
---|---|
교환 및 반품 접수가 가능한 경우 |
|
교환 및 반품 접수가 불가능한 경우 |
|
교환 및 반품 신청
교환 절차 |
|
---|---|
반품 절차 |
|
문의 0
로그인 후 문의를 할 수 있습니다.