상품 옵션 정보 | ||||||||
---|---|---|---|---|---|---|---|---|
카탈로그 번호 | CAS 번호 | 설명 | 상태 | 단위 | 판매가 | 할인가 | 가격(VAT포함) | 수량 / 장바구니 / 찜 |
I5386-25G | - | Merck I5386-25G Indole-3-butyric acid, 25 G pk | 재고문의 | pk | 327,690원 | - | 360,459원 | |
I5386-5G | - | Merck I5386-5G Indole-3-butyric acid, 5 G pk | 재고문의 | pk | 111,370원 | - | 122,507원 | |
I5386-1G | - | Merck I5386-1G Indole-3-butyric acid, 1 G pk | 재고문의 | pk | 46,430원 | - | 51,073원 |
Indole-3-butyric acid
suitable for plant cell culture, BioReagent
4-(3-Indolyl)butyric acid, 4-(3-Indolyl)butanoic acid, IBA
Quality Level
제품 라인
BioReagent
technique(s)
cell culture | plant: suitable
application(s)
agriculture
저장 온도
2-8°C
SMILES string
OC(=O)CCCc1c[nH]c2ccccc12
InChI
1S/C12H13NO2/c14-12(15)7-3-4-9-8-13-11-6-2-1-5-10(9)11/h1-2,5-6,8,13H,3-4,7H2,(H,14,15)
InChI key
JTEDVYBZBROSJT-UHFFFAOYSA-N
Indole-3-butyric acid (IBA) is auxin-family plant hormone (phytohormone). IBA is thought to be a precursor of indole-3-acetic acid (IAA) the most abundant and the basic auxin natively occurring and functioning in plants. IAA generates the majority of auxin effects in intact plants, and is the most potent native auxin.
배송/결제/교환/반품 안내
배송 정보
기본 배송비 |
| 교환/반품 배송비 |
|
---|---|---|---|
착불 배송비 |
| ||
교환/반품 배송비 |
|
결제 및 환불 안내
결제 방법 |
|
---|---|
취소 |
|
반품 |
|
환급 |
|
교환 및 반품 접수
교환 및 반품 접수 기한 |
|
---|---|
교환 및 반품 접수가 가능한 경우 |
|
교환 및 반품 접수가 불가능한 경우 |
|
교환 및 반품 신청
교환 절차 |
|
---|---|
반품 절차 |
|
문의 0
로그인 후 문의를 할 수 있습니다.