Thermo Fisher Scientific Staphylococcus aureus BioParticles Opsonizing Reagent
| 상품 옵션 정보 | ||||||||
|---|---|---|---|---|---|---|---|---|
| 카탈로그 번호 | CAS 번호 | 설명 | 상태 | 단위 | 판매가 | 할인가 | 가격(VAT포함) | 수량 / 장바구니 / 찜 |
| S2860 | - | Thermo Fisher Scientific S2860 Staphylococcus aureus BioParticles Opsonizing Reagent Each pk | 재고문의 | pk | 420,000원 | - | 462,000원 | |
다른 상품 둘러보기
Invitrogen™
Staphylococcus aureus BioParticles™ Opsonizing Reagent
The Staphylococcus aureus (Wood strain without protein A) BioParticles™ opsonizing agent is derived from highly purified rabbit polyclonal IgG antibodies자세히 알아보기
The Staphylococcus aureus (Wood strain without protein A) BioParticles™ opsonizing agent is derived from highly purified rabbit polyclonal IgG antibodies and specifically designed to enhance the uptake of the S. aureus BioParticles™ conjugates.
사양
수량1 unit
권장 스토리지Store in freezer (-5 to -30°C).
용도 (장비)Fluorescence Microscope
제품라인BioParticles™
분자식C12H2F8
MDL 번호MFCD00000312
배송 조건Room Temperature
InChi 키QWCHHUZAAGRHDB-UHFFFAOYSA-N
SMILESFC1=CC(F)=C(F)C(=C1F)C1=C(F)C(F)=CC(F)=C1F
IUPAC 이름2,2,3,3,5,5,6,6-octafluoro-1,1`-biphenyl
분자량(g/mol)298.14
Unit SizeEach
배송/결제/교환/반품 안내
배송 정보
| 기본 배송비 |
| 교환/반품 배송비 |
|
|---|---|---|---|
| 착불 배송비 |
| ||
| 교환/반품 배송비 |
| ||
결제 및 환불 안내
| 결제 방법 |
|
|---|---|
| 취소 |
|
| 반품 |
|
| 환급 |
|
교환 및 반품 접수
| 교환 및 반품 접수 기한 |
|
|---|---|
| 교환 및 반품 접수가 가능한 경우 |
|
| 교환 및 반품 접수가 불가능한 경우 |
|
교환 및 반품 신청
| 교환 절차 |
|
|---|---|
| 반품 절차 |
|
문의 0
로그인 후 문의를 할 수 있습니다.